There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 3 g | ||
| 5 g |
| CAS | 3006-60-8 |
| Synonyms | 3006-60-8; (2S,3R,4R,5R,6R)-3-Acetamido-6-(acetoxymethyl)tetrahydro-2H-pyran-2,4,5-triyl triacetate; 2-ACETAMIDO-1,3,4,6-TETRA-O-ACETYL-2-DEOXY-B-D-GALACTOPYRANOSE; [(2R,3R,4R,5R,6S)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methyl acetate; (2S,3R,4R,5R,6R)-3-Acetamido-6-(acetoxymethyl)-tetrahydro-2H-pyran-2,4,5-triyl triacetate |
| Formula | C16H23NO10 |
| MW | 389.35 |
| MDL No. | MFCD00214297 |
| InChI | InChI=1S/C16H23NO10/c1-7(18)17-13-15(25-10(4)21)14(24-9(3)20)12(6-23-8(2)19)27-16(13)26-11(5)22/h12-16H,6H2,1-5H3,(H,17,18)/t12-,13-,14+,15-,16-/m1/s1 |
| InChI Key | OVPIZHVSWNOZMN-IBEHDNSVSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |