There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 100 g | ||
| 250 g | ||
| 500 g | ||
| 1 kg |
| CAS | 9005-82-7 |
| Synonyms | maltotriose; alpha-maltotriose; 9005-82-7; Amylotriose; CHEBI:27931 |
| Formula | C18H32O16 |
| MW | 504.4 |
| MDL No. | MFCD00134652 |
| InChI | InChI=1S/C18H32O16/c19-1-4-7(22)8(23)12(27)17(31-4)34-15-6(3-21)32-18(13(28)10(15)25)33-14-5(2-20)30-16(29)11(26)9(14)24/h4-29H,1-3H2/t4-,5-,6-,7-,8+,9-,10-,11-,12-,13-,14-,15-,16+,17-,18-/m1/s1 |
| InChI Key | FYGDTMLNYKFZSV-PXXRMHSHSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |