There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 2 g | ||
| 5 g | ||
| 10 g |
| CAS | 106402-05-5 |
| Synonyms | Nonyl b-D-maltopyranoside; 106402-05-5; N-NONYL-BETA-D-MALTOSIDE; Nonyl 4-O-Alpha-D-Glucopyranosyl-Beta-D-Glucopyranoside; Nonyl beta-maltoside |
| Formula | C21H40O11 |
| MW | 468.54 |
| MDL No. | MFCD08062400 |
| InChI | InChI=1S/C21H40O11/c1-2-3-4-5-6-7-8-9-29-20-18(28)16(26)19(13(11-23)31-20)32-21-17(27)15(25)14(24)12(10-22)30-21/h12-28H,2-11H2,1H3/t12-,13-,14-,15+,16-,17-,18-,19-,20-,21-/m1/s1 |
| InChI Key | KCCBGPCYGBPHBR-ZESVGKPKSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |