There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 5 g | ||
| 10 g |
| CAS | 1338-41-6 |
| Synonyms | [(2R)-2-[(2R,3R,4S)-3,4-Dihydroxyoxolan-2-yl]-2-hydroxyethyl] octadecanoate; Arlacel 60; Sorbitan monostearate; Sorbitan C; Montane 60; 1,4-Anhydro-6-O-stearoyl-D-glucitol; Q907898 |
| Formula | C24H46O6 |
| MW | 430.62 |
| InChI | InChI=1S/C24H46O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(27)29-19-21(26)24-23(28)20(25)18-30-24/h20-21,23-26,28H,2-19H2,1H3/t20-,21+,23+,24+/m0/s1 |
| InChI Key | HVUMOYIDDBPOLL-XWVZOOPGSA-N |
| Purity | Min 95% |
| Form | Dried by centrifugal evaporation from a solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |