There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| Inquiry |
| CAS | 147025-05-6 |
| Synonyms | 147025-05-6; Decyl 2-acetamido-2-deoxy-beta-D-glucopyranoside; DECYL 2-ACETAMIDO-2-DEOXY-B-D-GLUCOPYRANOSIDE; C18H35NO6; AKOS002687855 |
| Formula | C18H35NO6 |
| MW | 361.47 |
| MDL No. | MFCD08704065 |
| InChI | InChI=1S/C18H35NO6/c1-3-4-5-6-7-8-9-10-11-24-18-15(19-13(2)21)17(23)16(22)14(12-20)25-18/h14-18,20,22-23H,3-12H2,1-2H3,(H,19,21)/t14-,15-,16-,17-,18-/m1/s1 |
| InChI Key | SVEBILVFMHQNKO-DUQPFJRNSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |