There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 3 g | ||
| 5 g |
| CAS | 58846-77-8 |
| Synonyms | 58846-77-8; Decyl beta-D-glucopyranoside; Decyl glucoside; N-Decyl-b-D-glucopyranoside; n-DECYL-beta-D-GLUCOPYRANOSIDE |
| Formula | C16H32O6 |
| MW | 320.42 |
| MDL No. | MFCD00063297 |
| InChI | InChI=1S/C16H32O6/c1-2-3-4-5-6-7-8-9-10-21-16-15(20)14(19)13(18)12(11-17)22-16/h12-20H,2-11H2,1H3/t12-,13-,14+,15-,16-/m1/s1 |
| InChI Key | JDRSMPFHFNXQRB-IBEHDNSVSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |