There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| Inquiry |
| CAS | 147025-06-7 |
| Synonyms | Dodecyl 2-acetamido-2-deoxy-beta-D-glucopyranoside; 147025-06-7; C20H39NO6; Dodecyl 2-acetamido-2-deoxy-b-D-glucopyranoside |
| Formula | C20H39NO6 |
| MW | 389.53 |
| MDL No. | MFCD08704101 |
| InChI | InChI=1S/C20H39NO6/c1-3-4-5-6-7-8-9-10-11-12-13-26-20-17(21-15(2)23)19(25)18(24)16(14-22)27-20/h16-20,22,24-25H,3-14H2,1-2H3,(H,21,23)/t16-,17-,18-,19-,20-/m1/s1 |
| InChI Key | YNPQAQWLYWACJR-LASHMREHSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |