There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 2 g | ||
| 5 g | ||
| 10 g |
| CAS | 115457-83-5 |
| Synonyms | Hecameg; 115457-83-5; 6-O-(N-Heptylcarbamoyl)methylglucoside; UNII-72L66T594H; ((2R,3S,4S,5R,6S)-3,4,5-Trihydroxy-6-methoxytetrahydro-2H-pyran-2-yl)methyl heptylcarbamate |
| Formula | C15H29NO7 |
| MW | 335.39 |
| MDL No. | MFCD00077425 |
| InChI | InChI=1S/C15H29NO7/c1-3-4-5-6-7-8-16-15(20)22-9-10-11(17)12(18)13(19)14(21-2)23-10/h10-14,17-19H,3-9H2,1-2H3,(H,16,20)/t10-,11-,12+,13-,14+/m1/s1 |
| InChI Key | XPIVOYOQXKNYHA-RGDJUOJXSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |