There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 500 mg | ||
| 1 g | ||
| 2 g | ||
| 3 g | ||
| 5 g |
| CAS | 59080-45-4 |
| Synonyms | Hexadecyl glucoside; Hexadecyl beta-D-glucopyranoside; cetyl beta-D-glucopyranoside; 75319-63-0; UNII-FBO31BAC2H |
| Formula | C12H24O6 |
| MW | 264.32 |
| MDL No. | MFCD00063305 |
| InChI | InChI=1S/C22H44O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-27-22-21(26)20(25)19(24)18(17-23)28-22/h18-26H,2-17H2,1H3/t18-,19-,20+,21-,22-/m1/s1 |
| InChI Key | PAEMERHSTIDLSE-QMCAAQAGSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |