There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 3 g | ||
| 5 g |
| CAS | 98854-15-0 |
| Synonyms | Nonyl beta-D-thioglucopyranoside; 98854-15-0; Nonyl b-D-thioglucopyranoside; Nonyl 1-thiohexopyranoside #; SCHEMBL416020 |
| Formula | C15H30O5S |
| MW | 322.46 |
| MDL No. | MFCD16621059 |
| InChI | InChI=1S/C15H30O5S/c1-2-3-4-5-6-7-8-9-21-15-14(19)13(18)12(17)11(10-16)20-15/h11-19H,2-10H2,1H3/t11-,12-,13+,14-,15+/m1/s1 |
| InChI Key | HICSQFRUQXWIGI-QMIVOQANSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |