There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| Inquiry |
| CAS | 190912-49-3 |
| Synonyms | 190912-49-3; Hexyl 2-acetamido-2-deoxy-beta-D-glucopyranoside; Hexyl 2-acetamido-2-deoxy-b-D-glucopyranoside; ZINC34580421; AKOS002687851 |
| Formula | C14H27NO6 |
| MW | 305.37 |
| MDL No. | MFCD08703746 |
| InChI | InChI=1S/C14H27NO6/c1-3-4-5-6-7-20-14-11(15-9(2)17)13(19)12(18)10(8-16)21-14/h10-14,16,18-19H,3-8H2,1-2H3,(H,15,17)/t10-,11-,12-,13-,14-/m1/s1 |
| InChI Key | PYQSNDGHZWMGCA-DHGKCCLASA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |