There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 5 g | ||
| 10 g | ||
| 25 g | ||
| 50 g | ||
| 100 g |
| CAS | 29836-26-8 |
| Synonyms | 29836-26-8; Octyl-beta-D-glucopyranoside; OCTYL BETA-D-GLUCOPYRANOSIDE; n-Octyl-beta-D-glucopyranoside; B-Octylglucoside |
| Formula | C14H28O6 |
| MW | 292.37 |
| MDL No. | MFCD00063288 |
| InChI | InChI=1S/C14H28O6/c1-2-3-4-5-6-7-8-19-14-13(18)12(17)11(16)10(9-15)20-14/h10-18H,2-9H2,1H3/t10-,11-,12+,13-,14-/m1/s1 |
| InChI Key | HEGSGKPQLMEBJL-RKQHYHRCSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |