There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 3 g | ||
| 5 g |
| CAS | 85316-98-9 |
| Synonyms | Mega-8; 85316-98-9; N-OCTANOYL-N-METHYLGLUCAMINE; Mega 8; N-(D-Glucityl)-N-methyloctanamide |
| Formula | C15H31NO6 |
| MW | 321.41 |
| InChI | InChI=1S/C15H31NO6/c1-3-4-5-6-7-8-13(20)16(2)9-11(18)14(21)15(22)12(19)10-17/h11-12,14-15,17-19,21-22H,3-10H2,1-2H3/t11-,12+,14+,15+/m0/s1 |
| InChI Key | SBWGZAXBCCNRTM-CTHBEMJXSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |