There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 3 g | ||
| 5 g |
| CAS | 85618-20-8 |
| Synonyms | 85618-20-8; Heptyl 1-thiohexopyranoside; Heptyl b-D-thioglucopyranoside; Heptyl beta-D-thioglucopyranoside; Heptyl-beta-D-1-thioglucopyranoside |
| Formula | C13H26O5S |
| MW | 294.41 |
| MDL No. | MFCD00043236 |
| InChI | InChI=1S/C13H26O5S/c1-2-3-4-5-6-7-19-13-12(17)11(16)10(15)9(8-14)18-13/h9-17H,2-8H2,1H3/t9-,10-,11+,12-,13+/m1/s1 |
| InChI Key | HPEGNLMTTNTJSP-LBELIVKGSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |