There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 2 g | ||
| 5 g | ||
| 10 g |
| CAS | 173725-28-5 |
| Synonyms | 173725-28-5; Nonyl 2-acetamido-2-deoxy-beta-D-glucopyranoside; N-((2R,3R,4R,5S,6R)-4,5-Dihydroxy-6-(hydroxymethyl)-2-(nonyloxy)tetrahydro-2H-pyran-3-yl)acetamide; Nonyl 2-acetamido-2-deoxy-b-D-glucopyranoside |
| Formula | C17H33NO6 |
| MW | 347.45 |
| MDL No. | MFCD08703872 |
| InChI | InChI=1S/C17H33NO6/c1-3-4-5-6-7-8-9-10-23-17-14(18-12(2)20)16(22)15(21)13(11-19)24-17/h13-17,19,21-22H,3-11H2,1-2H3,(H,18,20)/t13-,14-,15-,16-,17-/m1/s1 |
| InChI Key | CTRCWYGGVOETGG-WRQOLXDDSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |