There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 3 g | ||
| 5 g |
| CAS | 139361-84-5 |
| Synonyms | N-((2-Hydroxyethyl)glycyl)decanamide; 139361-84-5 |
| Formula | C18H37NO7 |
| MW | 379.49 |
| InChI | InChI=1S/C14H28N2O3/c1-2-3-4-5-6-7-8-9-13(18)16-14(19)12-15-10-11-17/h15,17H,2-12H2,1H3,(H,16,18,19) |
| InChI Key | MODDGVIIHAOFMU-UHFFFAOYSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |