There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 3 g | ||
| 5 g |
| CAS | 149342-80-3 |
| Synonyms | octyl alpha-D-galactopyranoside; 149342-80-3; Galp-alpha-octyl; SCHEMBL286977; KM5505 |
| Formula | C14H28O6 |
| MW | 292.37 |
| MDL No. | MFCD18642960 |
| InChI | InChI=1S/C14H28O6/c1-2-3-4-5-6-7-8-19-14-13(18)12(17)11(16)10(9-15)20-14/h10-18H,2-9H2,1H3/t10-,11+,12+,13-,14+/m1/s1 |
| InChI Key | HEGSGKPQLMEBJL-HTOAHKCRSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |