There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| Inquiry |
| CAS | 115414-49-8 |
| Synonyms | 115414-49-8; Hexadecyl 2-acetamido-2-deoxy-b-D-glucopyranoside; C24H47NO6; ZINC100052884; W0564 |
| Formula | C24H47NO6 |
| MW | 445.63 |
| MDL No. | MFCD08703744 |
| InChI | InChI=1S/C24H47NO6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-30-24-21(25-19(2)27)23(29)22(28)20(18-26)31-24/h20-24,26,28-29H,3-18H2,1-2H3,(H,25,27)/t20-,21-,22-,23-,24-/m1/s1 |
| InChI Key | WKLPLHUPPYUENY-MRKXFKPJSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |