There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 5 g | ||
| 10 g |
| CAS | 148616-91-5 |
| Synonyms | Octyl b-D-thiomaltopyranoside; 148616-91-5; OCTYL BETA-D-THIOMALTOPYRANOSIDE; Octyl-beta-D-thiomaltopyranoside; CTK8E7866 |
| Formula | C20H38O10S |
| MW | 470.58 |
| MDL No. | MFCD09750647 |
| InChI | InChI=1S/C20H38O10S/c1-2-3-4-5-6-7-8-31-20-17(27)15(25)18(12(10-22)29-20)30-19-16(26)14(24)13(23)11(9-21)28-19/h11-27H,2-10H2,1H3/t11-,12-,13-,14+,15-,16-,17-,18-,19-,20+/m1/s1 |
| InChI Key | JHBBNAKIOKQRJS-NQXZFOFXSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |