There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 3 g | ||
| 5 g |
| CAS | 69984-73-2 |
| Synonyms | 69984-73-2; B-Nonylglucoside; Nonyl beta-D-glucopyranoside; b-D-Glucopyranoside, nonyl; (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(nonyloxy)tetrahydro-2H-pyran-3,4,5-triol |
| Formula | C15H30O6 |
| MW | 306.4 |
| MDL No. | MFCD00063300 |
| InChI | InChI=1S/C15H30O6/c1-2-3-4-5-6-7-8-9-20-15-14(19)13(18)12(17)11(10-16)21-15/h11-19H,2-10H2,1H3/t11-,12-,13+,14-,15-/m1/s1 |
| InChI Key | QFAPUKLCALRPLH-UXXRCYHCSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |