There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 5 g | ||
| 10 g |
| CAS | 2277-23-8 |
| Synonyms | 2,3-Dihydroxypropyl decanoate; MONOCAPRIN; 26402-22-2; Glyceryl caprate; 2277-23-8 |
| Formula | C13H26O4 |
| MW | 246.34 |
| MDL No. | MFCD00056656 |
| InChI | InChI=1S/C13H26O4/c1-2-3-4-5-6-7-8-9-13(16)17-11-12(15)10-14/h12,14-15H,2-11H2,1H3 |
| InChI Key | LKUNXBRZDFMZOK-UHFFFAOYSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |