There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| Inquiry |
| CAS | 262856-90-6 |
| Synonyms | 262856-90-6; C25H49NO6; ZINC100057955; W0558; Heptadecyl 2-acetamido-2-deoxy-beta-D-glucopyranoside |
| Formula | C25H49NO6 |
| MW | 459.66 |
| MDL No. | MFCD08703740 |
| InChI | InChI=1S/C25H49NO6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-31-25-22(26-20(2)28)24(30)23(29)21(19-27)32-25/h21-25,27,29-30H,3-19H2,1-2H3,(H,26,28)/t21-,22-,23-,24-,25-/m1/s1 |
| InChI Key | DCEHHNFIKAKYJW-FXEFVXDJSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |