There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 3 g | ||
| 5 g |
| CAS | 870287-95-9 |
| Synonyms | Hexyl b-D-maltopyranoside; 870287-95-9; Hexyl beta-maltoside; Hexyl beta-D-maltopyranoside; CTK8E7870 |
| Formula | C18H34O11 |
| MW | 426.46 |
| MDL No. | MFCD09750646 |
| InChI | InChI=1S/C18H34O11/c1-2-3-4-5-6-26-17-15(25)13(23)16(10(8-20)28-17)29-18-14(24)12(22)11(21)9(7-19)27-18/h9-25H,2-8H2,1H3/t9-,10-,11-,12+,13-,14-,15-,16-,17-,18-/m1/s1 |
| InChI Key | KRYKGRXIHMMFCB-YMJSIHPXSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |