There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 3 g | ||
| 5 g |
| CAS | 98854-16-1 |
| Synonyms | 98854-16-1; Decyl b-D-thioglucopyranoside; Decyl beta-D-thioglucopyranoside; Decyl-beta-D-1-thioglucopyranoside; (2S,3R,4S,5S,6R)-2-(Decylthio)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol |
| Formula | C16H32O5S |
| MW | 336.49 |
| MDL No. | MFCD01862990 |
| InChI | InChI=1S/C16H32O5S/c1-2-3-4-5-6-7-8-9-10-22-16-15(20)14(19)13(18)12(11-17)21-16/h12-20H,2-11H2,1H3/t12-,13-,14+,15-,16+/m1/s1 |
| InChI Key | WXUWOACRYZHYQL-LJIZCISZSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |