There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 3 g | ||
| 5 g |
| CAS | 864434-14-0 |
| Synonyms | 864434-14-0; D-Glucitol |
| Formula | C17H33NO7 |
| MW | 363.45 |
| InChI | InChI=1S/C17H33NO7/c19-9-8-18(10-13(21)16(24)17(25)14(22)11-20)15(23)7-6-12-4-2-1-3-5-12/h12-14,16-17,19-22,24-25H,1-11H2/t13-,14+,16+,17+/m0/s1 |
| InChI Key | AHJZPLOICPCLQM-XOSAIJSUSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |