There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 5 g | ||
| 10 g | ||
| 25 g | ||
| 50 g | ||
| 100 g |
| CAS | 54549-23-4 |
| Synonyms | Octyl D-glucopyranoside; Octyl D-glucoside; 54549-23-4; Octyl glucopyranoside; Octyl glucoside |
| Formula | C14H28O6 |
| MW | 292.37 |
| MDL No. | MFCD00066073 |
| InChI | InChI=1S/C14H28O6/c1-2-3-4-5-6-7-8-19-14-13(18)12(17)11(16)10(9-15)20-14/h10-18H,2-9H2,1H3/t10-,11-,12+,13-,14?/m1/s1 |
| InChI Key | HEGSGKPQLMEBJL-RQICVUQASA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |