There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 3 g | ||
| 5 g |
| CAS | 864434-15-1 |
| Synonyms | 4-Cyclohexyl-N-((2-hydroxyethyl)glycyl)butanamide; 864434-15-1 |
| Formula | C18H35NO7 |
| MW | 377.47 |
| InChI | InChI=1S/C14H26N2O3/c17-10-9-15-11-14(19)16-13(18)8-4-7-12-5-2-1-3-6-12/h12,15,17H,1-11H2,(H,16,18,19) |
| InChI Key | FPPXPVRQLPOIFC-UHFFFAOYSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |