There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 3 g | ||
| 5 g |
| CAS | 82494-09-5 |
| Synonyms | 82494-09-5; Decyl beta-D-maltopyranoside; n-Decyl-beta-D-maltoside; Decyl 4-O-a-D-glucopyranosyl-b-D-glucopyranoside; DECYL-BETA-D-MALTOPYRANOSIDE |
| Formula | C22H42O11 |
| MW | 482.56 |
| MDL No. | MFCD00061624 |
| InChI | InChI=1S/C22H42O11/c1-2-3-4-5-6-7-8-9-10-30-21-19(29)17(27)20(14(12-24)32-21)33-22-18(28)16(26)15(25)13(11-23)31-22/h13-29H,2-12H2,1H3/t13-,14-,15-,16+,17-,18-,19-,20-,21-,22-/m1/s1 |
| InChI Key | WOQQAWHSKSSAGF-WXFJLFHKSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |