There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| Inquiry |
| CAS | 197390-85-5 |
| Synonyms | 197390-85-5; N-Octyl 2-Acetamido-2-deoxy-3-O-(beta-D-galactopyranosyl)-beta-D-glucopyranoside; CTK8E7864; FT-0673229; FT-0673230 |
| Formula | C22H41NO11 |
| MW | 495.56 |
| MDL No. | MFCD02683385 |
| InChI | InChI=1S/C22H41NO11/c1-3-4-5-6-7-8-9-31-21-15(23-12(2)26)20(17(28)14(11-25)32-21)34-22-19(30)18(29)16(27)13(10-24)33-22/h13-22,24-25,27-30H,3-11H2,1-2H3,(H,23,26) |
| InChI Key | LAVIBJFXURBICK-UHFFFAOYSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |