There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| Inquiry |
| CAS | 135198-04-8 |
| Synonyms | 135198-04-8; DECYL 2-ACETAMIDO-3,4,6-TRI-O-ACETYL-2-DEOXY-B-D-GLUCOPYRANOSIDE; C24H41NO9; AKOS002687841; ZINC100053199 |
| Formula | C24H41NO9 |
| MW | 487.58 |
| MDL No. | MFCD08704066 |
| InChI | InChI=1S/C24H41NO9/c1-6-7-8-9-10-11-12-13-14-30-24-21(25-16(2)26)23(33-19(5)29)22(32-18(4)28)20(34-24)15-31-17(3)27/h20-24H,6-15H2,1-5H3,(H,25,26)/t20-,21-,22-,23-,24-/m1/s1 |
| InChI Key | RVOHFQLIULTWCK-MRKXFKPJSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |