There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 3 g | ||
| 5 g |
| CAS | 82494-08-4 |
| Synonyms | 82494-08-4; n-Octyl-beta-D-maltopyranoside; Octyl maltopyranoside; Octyl 4-O-a-D-glucopyranosyl-b-D-glucopyranoside; N-OCTYL B-D-MALTOSIDE |
| Formula | C20H38O11 |
| MW | 454.51 |
| MDL No. | MFCD00065526 |
| InChI | InChI=1S/C20H38O11/c1-2-3-4-5-6-7-8-28-19-17(27)15(25)18(12(10-22)30-19)31-20-16(26)14(24)13(23)11(9-21)29-20/h11-27H,2-10H2,1H3/t11-,12-,13-,14+,15-,16-,17-,18-,19-,20-/m1/s1 |
| InChI Key | MASIZQYHVMQQKI-OIIXUNCGSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |