There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 5 mg | ||
| 10 mg |
| CAS | 128299-96-7 |
| Synonyms | 128299-96-7; OCTYL 2,3,4,6-TETRA-O-ACETYL-B-D-MANNOPYRANOSIDE; Octyl 2,3,4,6-O-Tetraacetyl-beta-D-mannopyranoside; ZINC77312041; W-201008 |
| Formula | C22H36O10 |
| MW | 460.52 |
| MDL No. | MFCD09841119 |
| InChI | InChI=1S/C22H36O10/c1-6-7-8-9-10-11-12-27-22-21(31-17(5)26)20(30-16(4)25)19(29-15(3)24)18(32-22)13-28-14(2)23/h18-22H,6-13H2,1-5H3/t18-,19-,20+,21+,22-/m1/s1 |
| InChI Key | RNGLREVZONTJLS-LXHROKJGSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |