There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 3 g | ||
| 5 g |
| CAS | 869638-31-3 |
| Synonyms | 869638-31-3; 2,6-Dimethyl-4-heptyl-b-D-maltopyranoside; ZINC100056706; W0118; 2,6-Dimethyl-4-heptyl-beta-D-maltopyranoside |
| Formula | C21H40O11 |
| MW | 468.54 |
| MDL No. | MFCD09750643 |
| InChI | InChI=1S/C21H40O11/c1-9(2)5-11(6-10(3)4)29-20-18(28)16(26)19(13(8-23)31-20)32-21-17(27)15(25)14(24)12(7-22)30-21/h9-28H,5-8H2,1-4H3/t12-,13-,14-,15+,16-,17-,18-,19-,20-,21-/m1/s1 |
| InChI Key | RCXNRCWFTSDLDY-ZESVGKPKSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |