There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 3 g | ||
| 5 g |
| CAS | 603111-75-7 |
| Synonyms | 2-Cyclohexyl-N-((2-hydroxyethyl)glycyl)acetamide; 603111-75-7 |
| Formula | C16H31NO7 |
| MW | 349.42 |
| InChI | InChI=1S/C12H22N2O3/c15-7-6-13-9-12(17)14-11(16)8-10-4-2-1-3-5-10/h10,13,15H,1-9H2,(H,14,16,17) |
| InChI Key | KJQMSIKDNXUVQD-UHFFFAOYSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |