There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 5 g | ||
| 10 g | ||
| 25 g | ||
| 50 g | ||
| 100 g |
| CAS | 83512-85-0 |
| Synonyms | Carboxymethyl chitosan; 83512-85-0; N-Acetylchitosan; Q763 |
| Formula | C20H37N3O14 |
| MW | 543.5 |
| MDL No. | MFCD00677440 |
| InChI | InChI=1S/C20H37N3O14/c1-5(27)23-11-15(31)17(36-19-10(22)13(29)12(28)6(2-24)34-19)8(4-26)35-20(11)37-16-7(3-25)33-18(32)9(21)14(16)30/h6-20,24-26,28-32H,2-4,21-22H2,1H3,(H,23,27)/t6-,7-,8-,9-,10-,11-,12-,13-,14-,15-,16?,17?,18-,19+,20+/m1/s1 |
| InChI Key | HGNQXZLWHDQLRE-XADFZESNSA-N |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |