There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 500 g | ||
| 1 kg | ||
| 2 kg |
| CAS | 9002-18-0 |
| Synonyms | Agar; 9002-18-0; Agar (bacteriological); (2R,3S,4S,5R)-2-(hydroxymethyl)-6-[[(4R,5S)-4-hydroxy-3-methyl-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-4-methoxyoxane-3,5-diol; AGAR AGAR BACTERIOLOGICAL |
| Formula | C14H24O9 |
| MW | 336.33 |
| MDL No. | MFCD00081288 |
| InChI | InChI=1S/C14H24O9/c1-5-8(16)13-11(7(21-5)4-20-13)23-14-10(18)12(19-2)9(17)6(3-15)22-14/h5-18H,3-4H2,1-2H3/t5?,6-,7?,8-,9+,10-,11?,12+,13+,14?/m1/s1 Computed by InChI 1.0.5 (PubChem release 2019.06.18) |
| InChI Key | GYYDPBCUIJTIBM-DYOGSRDZSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |