There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 10 μg | ||
| 30 μg | ||
| 50 μg | ||
| 100 μg |
| CAS | 66091-47-2 |
| Synonyms | SCHEMBL20840193; MAN-5 Glycan; 66091-47-2 |
| Formula | C46H78N2O36 |
| MW | 1235.1 |
| MDL No. | MFCD00467030 |
| InChI | InChI=1S/C46H78N2O36/c1-11(55)47-13(3-49)22(58)37(14(57)4-50)81-41-21(48-12(2)56)28(64)38(18(8-54)78-41)82-46-36(72)40(84-45-34(70)31(67)25(61)17(7-53)77-45)27(63)20(80-46)10-74-43-35(71)39(83-44-33(69)30(66)24(60)16(6-52)76-44)26(62)19(79-43)9-73-42-32(68)29(65)23(59)15(5-51)75-42/h3,13-46,50-54,57-72H,4-10H2,1-2H3,(H,47,55)(H,48,56) |
| InChI Key | KIAGZJJOMMNKBW-UHFFFAOYSA-N |
| Purity | min 90% 1H NMR and HPLC |
| Form | Freeze-dried solid |
| Identity | Conforms to structure (1H NMR) |
| Storage | Store at -20°C for long term storage. |