There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 5 kg | ||
| 10 kg | ||
| 25 kg | ||
| 50 kg | ||
| 100 kg |
| CAS | 5989-81-1 |
| Synonyms | Lactose monohydrate; 5989-81-1; alpha-D-Lactose monohydrate; alpha-Lactose monohydrate; a-Lactose monohydrate |
| Formula | C12H22O11·H2O |
| MW | 360.31 |
| MDL No. | MFCD00150747 |
| InChI | InChI=1S/C12H22O11.H2O/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17;/h3-20H,1-2H2;1H2/t3-,4-,5+,6+,7-,8-,9-,10-,11+,12+;/m1./s1 |
| InChI Key | WSVLPVUVIUVCRA-KPKNDVKVSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |