There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 25 g | ||
| 50 g | ||
| 100 g |
| CAS | 9036-66-2 |
| Synonyms | Galactoarabinan; 9036-66-2; (+)-Arabinogalactan; ARABINOGALACTAN; D-Galacto-L-arabinan |
| Formula | C20H36O14 |
| MW | 500.5 |
| MDL No. | MFCD00062638 |
| InChI | InChI=1S/C20H36O14/c1-7-11(23)18(12(24)9(4-21)32-7)34-20-15(27)17(29-3)13(25)10(33-20)6-31-19-14(26)16(28-2)8(22)5-30-19/h7-27H,4-6H2,1-3H3 |
| InChI Key | SATHPVQTSSUFFW-UHFFFAOYSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |