There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 25 g | ||
| 50 g | ||
| 100 g |
| CAS | 9004-35-7 |
| Synonyms | 9004-35-7; Acetylcellulose; Plastacele; Acetose; Allogel |
| Formula | C8H16O8 |
| MW | 264.23 |
| MDL No. | MFCD00081496 |
| InChI | InChI=1S/C10H16O8/c1-4(11)16-3-6-7(13)8(14)9(10(15)18-6)17-5(2)12/h6-10,13-15H,3H2,1-2H3/t6-,7-,8+,9-,10-/m1/s1 |
| InChI Key | SMEGJBVQLJJKKX-HOTMZDKISA-N |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |