There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 5 kg | ||
| 10 kg | ||
| 20 kg | ||
| 50 kg | ||
| 100 kg |
| CAS | 81025-04-9 |
| Synonyms | Lactitol monohydrate; 81025-04-9; D-Lactitol monohydrate; Lactitol (monohydrate); UNII-UH2K6W1Y64 |
| Formula | C12H24O11·H2O |
| MW | 362.33 |
| MDL No. | MFCD00150767 |
| InChI | InChI=1S/C12H24O11.H2O/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12;/h4-21H,1-3H2;1H2/t4-,5+,6+,7+,8-,9-,10+,11+,12-;/m0./s1 |
| InChI Key | LXMBXZRLTPSWCR-XBLONOLSSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |