There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 100 g | ||
| 250 g | ||
| 500 g | ||
| 1 kg |
| CAS | 96-82-2 |
| Synonyms | LACTOBIONIC ACID; 96-82-2; 4-O-beta-D-Galactopyranosyl-D-gluconic acid; UNII-65R938S4DV; 4-(beta-D-Galactosido)-D-gluconic acid |
| Formula | C12H22O12 |
| MW | 358.3 |
| MDL No. | MFCD00078147 |
| InChI | InChI=1S/C12H22O12/c13-1-3(15)10(7(18)8(19)11(21)22)24-12-9(20)6(17)5(16)4(2-14)23-12/h3-10,12-20H,1-2H2,(H,21,22)/t3-,4-,5+,6+,7-,8-,9-,10-,12+/m1/s1 |
| InChI Key | JYTUSYBCFIZPBE-AMTLMPIISA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |