There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 50 μg | ||
| 100 μg | ||
| 200 μg | ||
| 500 μg |
| CAS | 72468-43-0 |
| Synonyms | 72468-43-0; Fuc(a1-2)[Gal(a1-3)]Gal(b1-4)[Fuc(a1-3)]Glc; Blood Group B pentasaccharide; DTXSID80744278; CHEBI:147007 |
| Formula | C30H52O24 |
| MW | 796.72 |
| MDL No. | MFCD01076416 |
| InChI | InChI=1S/C30H52O24/c1-6-11(34)15(38)18(41)27(46-6)53-24-21(44)26(45)48-10(5-33)22(24)51-30-25(54-28-19(42)16(39)12(35)7(2)47-28)23(14(37)9(4-32)50-30)52-29-20(43)17(40)13(36)8(3-31)49-29/h6-45H,3-5H2,1-2H3/t6-,7-,8+,9+,10+,11+,12+,13-,14-,15+,16+,17-,18-,19-,20+,21+,22+,23-,24+,25+,26?,27-,28-,29+,30-/m0/s1 |
| InChI Key | CFAMAWVZEVLFJH-NCWFDBPASA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |