There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 50 g | ||
| 100 g | ||
| 250 g | ||
| 500 g |
| CAS | 9000-11-7 |
| Synonyms | Croscarmellose; Carmellose; 9000-11-7; Carboxymethylcellulose; Colloresine |
| Formula | C8H16O8 |
| MW | 240.21 |
| MDL No. | MFCD00149018 |
| InChI | InChI=1S/C6H12O6.C2H4O2/c7-1-3(9)5(11)6(12)4(10)2-8;1-2(3)4/h1,3-6,8-12H,2H2;1H3,(H,3,4) |
| InChI Key | VJHCJDRQFCCTHL-UHFFFAOYSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |