There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 50 g | ||
| 100 g | ||
| 250 g | ||
| 500 g |
| CAS | 9000-40-2 |
| Synonyms | 28663-68-5; STK367396; 2-chloro-2-(phenylhydrazono)acetic acid ethyl ester; Ethyl 2-chloro-2-(phenylhydrazono)acetate; Acetic acid, phenylhydrazonochloro-, ethyl ester; 9000-40-2 |
| Formula | C6H12O6 |
| MW | 180.16 |
| MDL No. | MFCD00131257 |
| InChI | InChI=1S/C10H11ClN2O2/c1-2-15-10(14)9(11)13-12-8-6-4-3-5-7-8/h3-7,12H,2H2,1H3/b13-9- |
| InChI Key | LZCJYKSOIZQABU-LCYFTJDESA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |