There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 10 mg |
| CAS | 20331-45-7 |
| Synonyms | 20331-45-7; Galbeta1-4GlcNAcbeta1-6Gal; beta-D-Gal-(1->4)-beta-D-GlcNAc-(1->6)-D-Gal; CHEBI:60214; beta-D-Galp-(1->4)-beta-D-GlcpNAc-(1->6)-D-Galp |
| Formula | C20H35NO16 |
| MW | 545.49 |
| MDL No. | MFCD00078855 |
| InChI | InChI=1S/C20H35NO16/c1-5(24)21-9-12(27)17(37-20-16(31)14(29)10(25)6(2-22)35-20)7(3-23)36-19(9)33-4-8-11(26)13(28)15(30)18(32)34-8/h6-20,22-23,25-32H,2-4H2,1H3,(H,21,24)/t6-,7-,8-,9-,10+,11+,12-,13+,14+,15-,16-,17-,18?,19-,20+/m1/s1 |
| InChI Key | VZIJAGXHAXHZJU-MRGJSYKYSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |