There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 5 g |
| CAS | 10605-09-1 |
| Synonyms | L-Ascorbyl-6-stearate; [(2S)-2-[(2R)-3,4-Dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] octadecanoate; 2-(3,4-Dihydroxy-5-oxo-2,5-dihydrofuran-2-yl)-2-hydroxyethyl octadecanoate; L-Ascorbic acid 6-stearate; 6-O-Stearoyl-L-ascorbic acid |
| Formula | C24H42O7 |
| MW | 442.6 |
| InChI | InChI=1S/C24H42O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(26)30-18-19(25)23-21(27)22(28)24(29)31-23/h19,23,25,27-28H,2-18H2,1H3/t19-,23+/m0/s1 |
| InChI Key | LITUBCVUXPBCGA-WMZHIEFXSA-N |
| Purity | Min 95% |
| Form | Dried by centrifugal evaporation from a solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |