There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 kg | ||
| 2 kg | ||
| 3 kg |
| CAS | 6363-53-7 |
| Synonyms | D-(+)-Maltose monohydrate; 6363-53-7; Maltose monohydrate; UNII-DM477EE40D; DM477EE40D |
| Formula | C12H22O11·H2O |
| MW | 360.31 |
| MDL No. | MFCD00149343 |
| InChI | InChI=1S/C12H22O11.H2O/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12;/h1,4-12,14-21H,2-3H2;1H2/t4-,5+,6+,7+,8+,9-,10+,11+,12+;/m0./s1 |
| InChI Key | HBDJFVFTHLOSDW-DNDLZOGFSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |