There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 250 g | ||
| 500 g | ||
| 1 kg | ||
| 2 kg |
| CAS | 100-79-8 |
| Synonyms | Solketal; 100-79-8; 2,2-Dimethyl-1,3-dioxolane-4-methanol; (2,2-Dimethyl-1,3-dioxolan-4-yl)methanol; Glycerolacetone; Dioxolan; 1,2-O-Isopropylideneglycerol |
| Formula | C6H12O3 |
| MW | 132.16 |
| MDL No. | MFCD00063238 |
| InChI | InChI=1S/C6H12O3/c1-6(2)8-4-5(3-7)9-6/h5,7H,3-4H2,1-2H3 |
| InChI Key | RNVYQYLELCKWAN-UHFFFAOYSA-N |
| Purity | min 95% by HPLC |
| Form | Clear, colourless liquid |
| Identity | Conforms to structure (1H NMR) |
| Storage | Store at -20°C for long term storage. |