There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 3 g | ||
| 5 g |
| CAS | 10385-50-9 |
| Synonyms | 10385-50-9; 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-a-D-galactopyranose; 1,3,4,6-Tetra-O-acetyl-2-(acetylamino)-2-deoxyhexopyranose #; SCHEMBL6332066; Pentaacetyl-.alpha.-D-galactosamine |
| Formula | C16H23NO10 |
| MW | 389.36 |
| MDL No. | MFCD15144916 |
| InChI | InChI=1S/C16H23NO10/c1-7(18)17-13-15(25-10(4)21)14(24-9(3)20)12(6-23-8(2)19)27-16(13)26-11(5)22/h12-16H,6H2,1-5H3,(H,17,18)/t12-,13-,14+,15-,16+/m1/s1 |
| InChI Key | OVPIZHVSWNOZMN-LJIZCISZSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |